C15H24N2S — CID 3101699
1,1-dibutyl-3-phenylthiourea (PubChem CID 3101699) has the molecular formula C15H24N2S and a molecular weight of 264.44 g/mol. Its IUPAC name is 1,1-dibutyl-3-phenylthiourea.
| Compound Name | 1,1-dibutyl-3-phenylthiourea |
|---|---|
| PubChem CID | 3101699 |
| Molecular Formula | C15H24N2S |
| Molecular Weight | 264.44 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 1,1-dibutyl-3-phenylthiourea |
| SMILES | CCCCN(CCCC)C(=S)Nc1ccccc1 |
| InChI | InChI=1S/C15H24N2S/c1-3-5-12-17(13-6-4-2)15(18)16-14-10-8-7-9-11-14/h7-11H,3-6,12-13H2,1-2H3,(H,16,18) |
| InChIKey | DALNRYKLXQFYLE-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|