C19H32N2S — CID 17283656
3-(4-butan-2-ylphenyl)-1,1-dibutylthiourea (PubChem CID 17283656) has the molecular formula C19H32N2S and a molecular weight of 320.55 g/mol. Its IUPAC name is 3-(4-butan-2-ylphenyl)-1,1-dibutylthiourea.
| Compound Name | 3-(4-butan-2-ylphenyl)-1,1-dibutylthiourea |
|---|---|
| PubChem CID | 17283656 |
| Molecular Formula | C19H32N2S |
| Molecular Weight | 320.55 g/mol |
| Exact Mass | 320.23 |
| IUPAC Name | 3-(4-butan-2-ylphenyl)-1,1-dibutylthiourea |
| SMILES | CCCCN(CCCC)C(=S)Nc1ccc(C(C)CC)cc1 |
| InChI | InChI=1S/C19H32N2S/c1-5-8-14-21(15-9-6-2)19(22)20-18-12-10-17(11-13-18)16(4)7-3/h10-13,16H,5-9,14-15H2,1-4H3,(H,20,22) |
| InChIKey | ZBBACXJAJNNNAY-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.55 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|