C19H30N2OS — CID 19653315
3-(4-acetylphenyl)-1,1-dipentylthiourea (PubChem CID 19653315) has the molecular formula C19H30N2OS and a molecular weight of 334.53 g/mol. Its IUPAC name is 3-(4-acetylphenyl)-1,1-dipentylthiourea.
| Compound Name | 3-(4-acetylphenyl)-1,1-dipentylthiourea |
|---|---|
| PubChem CID | 19653315 |
| Molecular Formula | C19H30N2OS |
| Molecular Weight | 334.53 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 3-(4-acetylphenyl)-1,1-dipentylthiourea |
| SMILES | CCCCCN(CCCCC)C(=S)Nc1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C19H30N2OS/c1-4-6-8-14-21(15-9-7-5-2)19(23)20-18-12-10-17(11-13-18)16(3)22/h10-13H,4-9,14-15H2,1-3H3,(H,20,23) |
| InChIKey | VZPCLPKGPRLYFS-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.53 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|