C19H32N2O2S — CID 17299033
3-(3,4-dimethoxyphenyl)-1,1-dipentylthiourea (PubChem CID 17299033) has the molecular formula C19H32N2O2S and a molecular weight of 352.54 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-1,1-dipentylthiourea.
| Compound Name | 3-(3,4-dimethoxyphenyl)-1,1-dipentylthiourea |
|---|---|
| PubChem CID | 17299033 |
| Molecular Formula | C19H32N2O2S |
| Molecular Weight | 352.54 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-1,1-dipentylthiourea |
| SMILES | CCCCCN(CCCCC)C(=S)Nc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C19H32N2O2S/c1-5-7-9-13-21(14-10-8-6-2)19(24)20-16-11-12-17(22-3)18(15-16)23-4/h11-12,15H,5-10,13-14H2,1-4H3,(H,20,24) |
| InChIKey | GQZYWDSIIMCJDB-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.54 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|