C18H32N4OS — CID 8615750
1,1-bis[3-(dimethylamino)propyl]-3-(3-methoxyphenyl)thiourea (PubChem CID 8615750) has the molecular formula C18H32N4OS and a molecular weight of 352.55 g/mol. Its IUPAC name is 1,1-bis[3-(dimethylamino)propyl]-3-(3-methoxyphenyl)thiourea.
| Compound Name | 1,1-bis[3-(dimethylamino)propyl]-3-(3-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 8615750 |
| Molecular Formula | C18H32N4OS |
| Molecular Weight | 352.55 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | 1,1-bis[3-(dimethylamino)propyl]-3-(3-methoxyphenyl)thiourea |
| SMILES | COc1cccc(NC(=S)N(CCCN(C)C)CCCN(C)C)c1 |
| InChI | InChI=1S/C18H32N4OS/c1-20(2)11-7-13-22(14-8-12-21(3)4)18(24)19-16-9-6-10-17(15-16)23-5/h6,9-10,15H,7-8,11-14H2,1-5H3,(H,19,24) |
| InChIKey | CBFKFZGDLCAOCY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 30.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.55 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|