C24H32N4OS — CID 3608698
1-[3-(diethylamino)propyl]-1-(1H-indol-3-ylmethyl)-3-(3-methoxyphenyl)thiourea (PubChem CID 3608698) has the molecular formula C24H32N4OS and a molecular weight of 424.61 g/mol. Its IUPAC name is 1-[3-(diethylamino)propyl]-1-(1H-indol-3-ylmethyl)-3-(3-methoxyphenyl)thiourea.
| Compound Name | 1-[3-(diethylamino)propyl]-1-(1H-indol-3-ylmethyl)-3-(3-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 3608698 |
| Molecular Formula | C24H32N4OS |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | 1-[3-(diethylamino)propyl]-1-(1H-indol-3-ylmethyl)-3-(3-methoxyphenyl)thiourea |
| SMILES | CCN(CC)CCCN(Cc1c[nH]c2ccccc12)C(=S)Nc1cccc(OC)c1 |
| InChI | InChI=1S/C24H32N4OS/c1-4-27(5-2)14-9-15-28(18-19-17-25-23-13-7-6-12-22(19)23)24(30)26-20-10-8-11-21(16-20)29-3/h6-8,10-13,16-17,25H,4-5,9,14-15,18H2,1-3H3,(H,26,30) |
| InChIKey | ZAXFLAZEHAPZPW-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 43.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|