C26H35ClN4OS — CID 53204645
3-(3-chloro-4-methoxyphenyl)-1-[3-(diethylamino)propyl]-1-[(1-ethylindol-3-yl)methyl]thiourea (PubChem CID 53204645) has the molecular formula C26H35ClN4OS and a molecular weight of 487.11 g/mol. Its IUPAC name is 3-(3-chloro-4-methoxyphenyl)-1-[3-(diethylamino)propyl]-1-[(1-ethylindol-3-yl)methyl]thiourea.
| Compound Name | 3-(3-chloro-4-methoxyphenyl)-1-[3-(diethylamino)propyl]-1-[(1-ethylindol-3-yl)methyl]thiourea |
|---|---|
| PubChem CID | 53204645 |
| Molecular Formula | C26H35ClN4OS |
| Molecular Weight | 487.11 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | 3-(3-chloro-4-methoxyphenyl)-1-[3-(diethylamino)propyl]-1-[(1-ethylindol-3-yl)methyl]thiourea |
| SMILES | CCN(CC)CCCN(Cc1cn(CC)c2ccccc12)C(=S)Nc1ccc(OC)c(Cl)c1 |
| InChI | InChI=1S/C26H35ClN4OS/c1-5-29(6-2)15-10-16-31(26(33)28-21-13-14-25(32-4)23(27)17-21)19-20-18-30(7-3)24-12-9-8-11-22(20)24/h8-9,11-14,17-18H,5-7,10,15-16,19H2,1-4H3,(H,28,33) |
| InChIKey | MTHMIFWHNGSWJE-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 32.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.11 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|