C23H28ClN3OS — CID 92660914
1-[(2R)-butan-2-yl]-3-(4-chloro-2-methoxyphenyl)-1-[(1-ethylindol-3-yl)methyl]thiourea (PubChem CID 92660914) has the molecular formula C23H28ClN3OS and a molecular weight of 430.02 g/mol. Its IUPAC name is 1-[(2R)-butan-2-yl]-3-(4-chloro-2-methoxyphenyl)-1-[(1-ethylindol-3-yl)methyl]thiourea.
| Compound Name | 1-[(2R)-butan-2-yl]-3-(4-chloro-2-methoxyphenyl)-1-[(1-ethylindol-3-yl)methyl]thiourea |
|---|---|
| PubChem CID | 92660914 |
| Molecular Formula | C23H28ClN3OS |
| Molecular Weight | 430.02 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 1-[(2R)-butan-2-yl]-3-(4-chloro-2-methoxyphenyl)-1-[(1-ethylindol-3-yl)methyl]thiourea |
| SMILES | CC[C@@H](C)N(Cc1cn(CC)c2ccccc12)C(=S)Nc1ccc(Cl)cc1OC |
| InChI | InChI=1S/C23H28ClN3OS/c1-5-16(3)27(23(29)25-20-12-11-18(24)13-22(20)28-4)15-17-14-26(6-2)21-10-8-7-9-19(17)21/h7-14,16H,5-6,15H2,1-4H3,(H,25,29)/t16-/m1/s1 |
| InChIKey | WAFPMQZHKQUIGY-MRXNPFEDSA-N |
| XLogP | 6.32 |
| TPSA | 29.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.02 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|