C24H32ClN3O3S — CID 17387905
3-(4-chloro-2-methoxyphenyl)-1-[(2-ethoxyphenyl)methyl]-1-(3-morpholin-4-ylpropyl)thiourea (PubChem CID 17387905) has the molecular formula C24H32ClN3O3S and a molecular weight of 478.06 g/mol. Its IUPAC name is 3-(4-chloro-2-methoxyphenyl)-1-[(2-ethoxyphenyl)methyl]-1-(3-morpholin-4-ylpropyl)thiourea.
| Compound Name | 3-(4-chloro-2-methoxyphenyl)-1-[(2-ethoxyphenyl)methyl]-1-(3-morpholin-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 17387905 |
| Molecular Formula | C24H32ClN3O3S |
| Molecular Weight | 478.06 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | 3-(4-chloro-2-methoxyphenyl)-1-[(2-ethoxyphenyl)methyl]-1-(3-morpholin-4-ylpropyl)thiourea |
| SMILES | CCOc1ccccc1CN(CCCN1CCOCC1)C(=S)Nc1ccc(Cl)cc1OC |
| InChI | InChI=1S/C24H32ClN3O3S/c1-3-31-22-8-5-4-7-19(22)18-28(12-6-11-27-13-15-30-16-14-27)24(32)26-21-10-9-20(25)17-23(21)29-2/h4-5,7-10,17H,3,6,11-16,18H2,1-2H3,(H,26,32) |
| InChIKey | DGTMWVKLEBSXIH-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 46.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.06 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|