C23H22Cl2N2OS — CID 44665600
1-benzyl-3-(2,4-dichlorophenyl)-1-[(2-ethoxyphenyl)methyl]thiourea (PubChem CID 44665600) has the molecular formula C23H22Cl2N2OS and a molecular weight of 445.42 g/mol. Its IUPAC name is 1-benzyl-3-(2,4-dichlorophenyl)-1-[(2-ethoxyphenyl)methyl]thiourea.
| Compound Name | 1-benzyl-3-(2,4-dichlorophenyl)-1-[(2-ethoxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 44665600 |
| Molecular Formula | C23H22Cl2N2OS |
| Molecular Weight | 445.42 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | 1-benzyl-3-(2,4-dichlorophenyl)-1-[(2-ethoxyphenyl)methyl]thiourea |
| SMILES | CCOc1ccccc1CN(Cc1ccccc1)C(=S)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H22Cl2N2OS/c1-2-28-22-11-7-6-10-18(22)16-27(15-17-8-4-3-5-9-17)23(29)26-21-13-12-19(24)14-20(21)25/h3-14H,2,15-16H2,1H3,(H,26,29) |
| InChIKey | JHOZCQXNDBISAI-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.42 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|