C23H20Cl2N2OS2 — CID 11488359
[2-(2,4-dichloroanilino)-2-oxoethyl] N,N-dibenzylcarbamodithioate (PubChem CID 11488359) has the molecular formula C23H20Cl2N2OS2 and a molecular weight of 475.47 g/mol. Its IUPAC name is [2-(2,4-dichloroanilino)-2-oxoethyl] N,N-dibenzylcarbamodithioate.
| Compound Name | [2-(2,4-dichloroanilino)-2-oxoethyl] N,N-dibenzylcarbamodithioate |
|---|---|
| PubChem CID | 11488359 |
| Molecular Formula | C23H20Cl2N2OS2 |
| Molecular Weight | 475.47 g/mol |
| Exact Mass | 474.04 |
| IUPAC Name | [2-(2,4-dichloroanilino)-2-oxoethyl] N,N-dibenzylcarbamodithioate |
| SMILES | O=C(CSC(=S)N(Cc1ccccc1)Cc1ccccc1)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H20Cl2N2OS2/c24-19-11-12-21(20(25)13-19)26-22(28)16-30-23(29)27(14-17-7-3-1-4-8-17)15-18-9-5-2-6-10-18/h1-13H,14-16H2,(H,26,28) |
| InChIKey | KPMZQCRLBRJIHT-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.47 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|