C17H16Cl2N2O3 — CID 108502823
N'-benzyl-N-(2,4-dichlorophenyl)-N'-(2-hydroxyethyl)oxamide (PubChem CID 108502823) has the molecular formula C17H16Cl2N2O3 and a molecular weight of 367.23 g/mol. Its IUPAC name is N'-benzyl-N-(2,4-dichlorophenyl)-N'-(2-hydroxyethyl)oxamide.
| Compound Name | N'-benzyl-N-(2,4-dichlorophenyl)-N'-(2-hydroxyethyl)oxamide |
|---|---|
| PubChem CID | 108502823 |
| Molecular Formula | C17H16Cl2N2O3 |
| Molecular Weight | 367.23 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | N'-benzyl-N-(2,4-dichlorophenyl)-N'-(2-hydroxyethyl)oxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1Cl)C(=O)N(CCO)Cc1ccccc1 |
| InChI | InChI=1S/C17H16Cl2N2O3/c18-13-6-7-15(14(19)10-13)20-16(23)17(24)21(8-9-22)11-12-4-2-1-3-5-12/h1-7,10,22H,8-9,11H2,(H,20,23) |
| InChIKey | ITNZQAFAQZWELO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.23 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|