C22H18Cl2N2O2 — CID 108500761
N',N'-dibenzyl-N-(2,3-dichlorophenyl)oxamide (PubChem CID 108500761) has the molecular formula C22H18Cl2N2O2 and a molecular weight of 413.30 g/mol. Its IUPAC name is N',N'-dibenzyl-N-(2,3-dichlorophenyl)oxamide.
| Compound Name | N',N'-dibenzyl-N-(2,3-dichlorophenyl)oxamide |
|---|---|
| PubChem CID | 108500761 |
| Molecular Formula | C22H18Cl2N2O2 |
| Molecular Weight | 413.30 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | N',N'-dibenzyl-N-(2,3-dichlorophenyl)oxamide |
| SMILES | O=C(Nc1cccc(Cl)c1Cl)C(=O)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C22H18Cl2N2O2/c23-18-12-7-13-19(20(18)24)25-21(27)22(28)26(14-16-8-3-1-4-9-16)15-17-10-5-2-6-11-17/h1-13H,14-15H2,(H,25,27) |
| InChIKey | YJMIPKPMFMPPQC-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.30 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|