C21H18ClFN2O — CID 108896524
1,1-dibenzyl-3-(2-chloro-6-fluorophenyl)urea (PubChem CID 108896524) has the molecular formula C21H18ClFN2O and a molecular weight of 368.84 g/mol. Its IUPAC name is 1,1-dibenzyl-3-(2-chloro-6-fluorophenyl)urea.
| Compound Name | 1,1-dibenzyl-3-(2-chloro-6-fluorophenyl)urea |
|---|---|
| PubChem CID | 108896524 |
| Molecular Formula | C21H18ClFN2O |
| Molecular Weight | 368.84 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 1,1-dibenzyl-3-(2-chloro-6-fluorophenyl)urea |
| SMILES | O=C(Nc1c(F)cccc1Cl)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C21H18ClFN2O/c22-18-12-7-13-19(23)20(18)24-21(26)25(14-16-8-3-1-4-9-16)15-17-10-5-2-6-11-17/h1-13H,14-15H2,(H,24,26) |
| InChIKey | VBGMGEUMBZRMSQ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.84 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |