C17H15F2N3O — CID 3325886
1-benzyl-1-(2-cyanoethyl)-3-(2,6-difluorophenyl)urea (PubChem CID 3325886) has the molecular formula C17H15F2N3O and a molecular weight of 315.32 g/mol. Its IUPAC name is 1-benzyl-1-(2-cyanoethyl)-3-(2,6-difluorophenyl)urea.
| Compound Name | 1-benzyl-1-(2-cyanoethyl)-3-(2,6-difluorophenyl)urea |
|---|---|
| PubChem CID | 3325886 |
| Molecular Formula | C17H15F2N3O |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 1-benzyl-1-(2-cyanoethyl)-3-(2,6-difluorophenyl)urea |
| SMILES | N#CCCN(Cc1ccccc1)C(=O)Nc1c(F)cccc1F |
| InChI | InChI=1S/C17H15F2N3O/c18-14-8-4-9-15(19)16(14)21-17(23)22(11-5-10-20)12-13-6-2-1-3-7-13/h1-4,6-9H,5,11-12H2,(H,21,23) |
| InChIKey | APDILZPMJNIXAH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |