C19H21N3O3 — CID 3325887
1-benzyl-1-(2-cyanoethyl)-3-(2,4-dimethoxyphenyl)urea (PubChem CID 3325887) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is 1-benzyl-1-(2-cyanoethyl)-3-(2,4-dimethoxyphenyl)urea.
| Compound Name | 1-benzyl-1-(2-cyanoethyl)-3-(2,4-dimethoxyphenyl)urea |
|---|---|
| PubChem CID | 3325887 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 1-benzyl-1-(2-cyanoethyl)-3-(2,4-dimethoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)N(CCC#N)Cc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C19H21N3O3/c1-24-16-9-10-17(18(13-16)25-2)21-19(23)22(12-6-11-20)14-15-7-4-3-5-8-15/h3-5,7-10,13H,6,12,14H2,1-2H3,(H,21,23) |
| InChIKey | DGWQGWKPHCBGBD-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |