C27H31N3O4 — CID 42699861
3-[benzyl-[(2,4-dimethoxyphenyl)carbamoyl]amino]-N-(1-phenylethyl)propanamide (PubChem CID 42699861) has the molecular formula C27H31N3O4 and a molecular weight of 461.56 g/mol. Its IUPAC name is 3-[benzyl-[(2,4-dimethoxyphenyl)carbamoyl]amino]-N-(1-phenylethyl)propanamide.
| Compound Name | 3-[benzyl-[(2,4-dimethoxyphenyl)carbamoyl]amino]-N-(1-phenylethyl)propanamide |
|---|---|
| PubChem CID | 42699861 |
| Molecular Formula | C27H31N3O4 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | 3-[benzyl-[(2,4-dimethoxyphenyl)carbamoyl]amino]-N-(1-phenylethyl)propanamide |
| SMILES | COc1ccc(NC(=O)N(CCC(=O)NC(C)c2ccccc2)Cc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C27H31N3O4/c1-20(22-12-8-5-9-13-22)28-26(31)16-17-30(19-21-10-6-4-7-11-21)27(32)29-24-15-14-23(33-2)18-25(24)34-3/h4-15,18,20H,16-17,19H2,1-3H3,(H,28,31)(H,29,32) |
| InChIKey | DJMJLIGXGZGFHQ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |