C19H23N3O4 — CID 113120669
3-[acetyl(pyridin-4-ylmethyl)amino]-N-(2,4-dimethoxyphenyl)propanamide (PubChem CID 113120669) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is 3-[acetyl(pyridin-4-ylmethyl)amino]-N-(2,4-dimethoxyphenyl)propanamide.
| Compound Name | 3-[acetyl(pyridin-4-ylmethyl)amino]-N-(2,4-dimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 113120669 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 3-[acetyl(pyridin-4-ylmethyl)amino]-N-(2,4-dimethoxyphenyl)propanamide |
| SMILES | COc1ccc(NC(=O)CCN(Cc2ccncc2)C(C)=O)c(OC)c1 |
| InChI | InChI=1S/C19H23N3O4/c1-14(23)22(13-15-6-9-20-10-7-15)11-8-19(24)21-17-5-4-16(25-2)12-18(17)26-3/h4-7,9-10,12H,8,11,13H2,1-3H3,(H,21,24) |
| InChIKey | TXEAWUBLXWFTAS-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |