C13H18F2N2O — CID 108991003
3-(2,6-difluorophenyl)-1,1-dipropylurea (PubChem CID 108991003) has the molecular formula C13H18F2N2O and a molecular weight of 256.30 g/mol. Its IUPAC name is 3-(2,6-difluorophenyl)-1,1-dipropylurea.
| Compound Name | 3-(2,6-difluorophenyl)-1,1-dipropylurea |
|---|---|
| PubChem CID | 108991003 |
| Molecular Formula | C13H18F2N2O |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 3-(2,6-difluorophenyl)-1,1-dipropylurea |
| SMILES | CCCN(CCC)C(=O)Nc1c(F)cccc1F |
| InChI | InChI=1S/C13H18F2N2O/c1-3-8-17(9-4-2)13(18)16-12-10(14)6-5-7-11(12)15/h5-7H,3-4,8-9H2,1-2H3,(H,16,18) |
| InChIKey | FGYMDZHIGJMXRH-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |