C22H18F4N2O — CID 1057646
1-benzyl-3-(3-fluorophenyl)-1-[[4-(trifluoromethyl)phenyl]methyl]urea (PubChem CID 1057646) has the molecular formula C22H18F4N2O and a molecular weight of 402.39 g/mol. Its IUPAC name is 1-benzyl-3-(3-fluorophenyl)-1-[[4-(trifluoromethyl)phenyl]methyl]urea.
| Compound Name | 1-benzyl-3-(3-fluorophenyl)-1-[[4-(trifluoromethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 1057646 |
| Molecular Formula | C22H18F4N2O |
| Molecular Weight | 402.39 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 1-benzyl-3-(3-fluorophenyl)-1-[[4-(trifluoromethyl)phenyl]methyl]urea |
| SMILES | O=C(Nc1cccc(F)c1)N(Cc1ccccc1)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H18F4N2O/c23-19-7-4-8-20(13-19)27-21(29)28(14-16-5-2-1-3-6-16)15-17-9-11-18(12-10-17)22(24,25)26/h1-13H,14-15H2,(H,27,29) |
| InChIKey | IREXRZZHCIBGPF-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.39 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |