C27H30FN3O2S — CID 1060058
N-benzyl-2-[cyclohexyl-[(3-fluorophenyl)carbamoyl]amino]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 1060058) has the molecular formula C27H30FN3O2S and a molecular weight of 479.62 g/mol. Its IUPAC name is N-benzyl-2-[cyclohexyl-[(3-fluorophenyl)carbamoyl]amino]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | N-benzyl-2-[cyclohexyl-[(3-fluorophenyl)carbamoyl]amino]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 1060058 |
| Molecular Formula | C27H30FN3O2S |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | N-benzyl-2-[cyclohexyl-[(3-fluorophenyl)carbamoyl]amino]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | O=C(CN(C(=O)Nc1cccc(F)c1)C1CCCCC1)N(Cc1ccccc1)Cc1cccs1 |
| InChI | InChI=1S/C27H30FN3O2S/c28-22-11-7-12-23(17-22)29-27(33)31(24-13-5-2-6-14-24)20-26(32)30(19-25-15-8-16-34-25)18-21-9-3-1-4-10-21/h1,3-4,7-12,15-17,24H,2,5-6,13-14,18-20H2,(H,29,33) |
| InChIKey | ZQILYSBJTSMYMB-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |