C29H35N3O2S — CID 1060062
N-benzyl-2-[cyclohexyl-[(4-ethylphenyl)carbamoyl]amino]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 1060062) has the molecular formula C29H35N3O2S and a molecular weight of 489.69 g/mol. Its IUPAC name is N-benzyl-2-[cyclohexyl-[(4-ethylphenyl)carbamoyl]amino]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | N-benzyl-2-[cyclohexyl-[(4-ethylphenyl)carbamoyl]amino]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 1060062 |
| Molecular Formula | C29H35N3O2S |
| Molecular Weight | 489.69 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | N-benzyl-2-[cyclohexyl-[(4-ethylphenyl)carbamoyl]amino]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | CCc1ccc(NC(=O)N(CC(=O)N(Cc2ccccc2)Cc2cccs2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C29H35N3O2S/c1-2-23-15-17-25(18-16-23)30-29(34)32(26-12-7-4-8-13-26)22-28(33)31(21-27-14-9-19-35-27)20-24-10-5-3-6-11-24/h3,5-6,9-11,14-19,26H,2,4,7-8,12-13,20-22H2,1H3,(H,30,34) |
| InChIKey | LYZSYEDZSHUPQR-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.69 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |