C31H41N3O2S — CID 3995283
2-[1-adamantylcarbamoyl(cyclohexyl)amino]-N-benzyl-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 3995283) has the molecular formula C31H41N3O2S and a molecular weight of 519.76 g/mol. Its IUPAC name is 2-[1-adamantylcarbamoyl(cyclohexyl)amino]-N-benzyl-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[1-adamantylcarbamoyl(cyclohexyl)amino]-N-benzyl-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 3995283 |
| Molecular Formula | C31H41N3O2S |
| Molecular Weight | 519.76 g/mol |
| Exact Mass | 519.29 |
| IUPAC Name | 2-[1-adamantylcarbamoyl(cyclohexyl)amino]-N-benzyl-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | O=C(CN(C(=O)NC12CC3CC(CC(C3)C1)C2)C1CCCCC1)N(Cc1ccccc1)Cc1cccs1 |
| InChI | InChI=1S/C31H41N3O2S/c35-29(33(21-28-12-7-13-37-28)20-23-8-3-1-4-9-23)22-34(27-10-5-2-6-11-27)30(36)32-31-17-24-14-25(18-31)16-26(15-24)19-31/h1,3-4,7-9,12-13,24-27H,2,5-6,10-11,14-22H2,(H,32,36) |
| InChIKey | YODMCGHKSYDGMV-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.76 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |