C30H41N3O3S — CID 5034342
2-[1-adamantylcarbamoyl(3-ethoxypropyl)amino]-N-benzyl-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 5034342) has the molecular formula C30H41N3O3S and a molecular weight of 523.74 g/mol. Its IUPAC name is 2-[1-adamantylcarbamoyl(3-ethoxypropyl)amino]-N-benzyl-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[1-adamantylcarbamoyl(3-ethoxypropyl)amino]-N-benzyl-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 5034342 |
| Molecular Formula | C30H41N3O3S |
| Molecular Weight | 523.74 g/mol |
| Exact Mass | 523.29 |
| IUPAC Name | 2-[1-adamantylcarbamoyl(3-ethoxypropyl)amino]-N-benzyl-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | CCOCCCN(CC(=O)N(Cc1ccccc1)Cc1cccs1)C(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C30H41N3O3S/c1-2-36-12-7-11-32(29(35)31-30-17-24-14-25(18-30)16-26(15-24)19-30)22-28(34)33(21-27-10-6-13-37-27)20-23-8-4-3-5-9-23/h3-6,8-10,13,24-26H,2,7,11-12,14-22H2,1H3,(H,31,35) |
| InChIKey | TVQLYYQWRMBCCD-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.74 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|