C28H29F6N3O3S — CID 3903281
N-benzyl-2-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl-(3-ethoxypropyl)amino]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 3903281) has the molecular formula C28H29F6N3O3S and a molecular weight of 601.61 g/mol. Its IUPAC name is N-benzyl-2-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl-(3-ethoxypropyl)amino]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | N-benzyl-2-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl-(3-ethoxypropyl)amino]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 3903281 |
| Molecular Formula | C28H29F6N3O3S |
| Molecular Weight | 601.61 g/mol |
| Exact Mass | 601.18 |
| IUPAC Name | N-benzyl-2-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl-(3-ethoxypropyl)amino]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | CCOCCCN(CC(=O)N(Cc1ccccc1)Cc1cccs1)C(=O)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H29F6N3O3S/c1-2-40-12-7-11-36(26(39)35-23-15-21(27(29,30)31)14-22(16-23)28(32,33)34)19-25(38)37(18-24-10-6-13-41-24)17-20-8-4-3-5-9-20/h3-6,8-10,13-16H,2,7,11-12,17-19H2,1H3,(H,35,39) |
| InChIKey | QWILAQOAKJFDBQ-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.61 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|