C28H37N3O2S — CID 4029663
2-[1-adamantylcarbamoyl(propyl)amino]-N-benzyl-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 4029663) has the molecular formula C28H37N3O2S and a molecular weight of 479.69 g/mol. Its IUPAC name is 2-[1-adamantylcarbamoyl(propyl)amino]-N-benzyl-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[1-adamantylcarbamoyl(propyl)amino]-N-benzyl-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 4029663 |
| Molecular Formula | C28H37N3O2S |
| Molecular Weight | 479.69 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | 2-[1-adamantylcarbamoyl(propyl)amino]-N-benzyl-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | CCCN(CC(=O)N(Cc1ccccc1)Cc1cccs1)C(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C28H37N3O2S/c1-2-10-30(27(33)29-28-15-22-12-23(16-28)14-24(13-22)17-28)20-26(32)31(19-25-9-6-11-34-25)18-21-7-4-3-5-8-21/h3-9,11,22-24H,2,10,12-20H2,1H3,(H,29,33) |
| InChIKey | OYEVXSCNLYHICH-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.69 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |