C27H29BrN2O2S — CID 5018410
N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-3-bromo-N-cyclohexylbenzamide (PubChem CID 5018410) has the molecular formula C27H29BrN2O2S and a molecular weight of 525.51 g/mol. Its IUPAC name is N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-3-bromo-N-cyclohexylbenzamide.
| Compound Name | N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-3-bromo-N-cyclohexylbenzamide |
|---|---|
| PubChem CID | 5018410 |
| Molecular Formula | C27H29BrN2O2S |
| Molecular Weight | 525.51 g/mol |
| Exact Mass | 524.11 |
| IUPAC Name | N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-3-bromo-N-cyclohexylbenzamide |
| SMILES | O=C(CN(C(=O)c1cccc(Br)c1)C1CCCCC1)N(Cc1ccccc1)Cc1cccs1 |
| InChI | InChI=1S/C27H29BrN2O2S/c28-23-12-7-11-22(17-23)27(32)30(24-13-5-2-6-14-24)20-26(31)29(19-25-15-8-16-33-25)18-21-9-3-1-4-10-21/h1,3-4,7-12,15-17,24H,2,5-6,13-14,18-20H2 |
| InChIKey | ZQFZPYWPUDGXAT-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.51 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |