C25H26N2O3S — CID 5145973
N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-cyclopropyl-4-methoxybenzamide (PubChem CID 5145973) has the molecular formula C25H26N2O3S and a molecular weight of 434.56 g/mol. Its IUPAC name is N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-cyclopropyl-4-methoxybenzamide.
| Compound Name | N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-cyclopropyl-4-methoxybenzamide |
|---|---|
| PubChem CID | 5145973 |
| Molecular Formula | C25H26N2O3S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-cyclopropyl-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)N(CC(=O)N(Cc2ccccc2)Cc2cccs2)C2CC2)cc1 |
| InChI | InChI=1S/C25H26N2O3S/c1-30-22-13-9-20(10-14-22)25(29)27(21-11-12-21)18-24(28)26(17-23-8-5-15-31-23)16-19-6-3-2-4-7-19/h2-10,13-15,21H,11-12,16-18H2,1H3 |
| InChIKey | AZJDKYYPMLIAGS-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |