C28H33N3O2S — CID 3602841
N-benzyl-2-[cyclohexyl-[(4-methylphenyl)carbamoyl]amino]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 3602841) has the molecular formula C28H33N3O2S and a molecular weight of 475.66 g/mol. Its IUPAC name is N-benzyl-2-[cyclohexyl-[(4-methylphenyl)carbamoyl]amino]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | N-benzyl-2-[cyclohexyl-[(4-methylphenyl)carbamoyl]amino]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 3602841 |
| Molecular Formula | C28H33N3O2S |
| Molecular Weight | 475.66 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | N-benzyl-2-[cyclohexyl-[(4-methylphenyl)carbamoyl]amino]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | Cc1ccc(NC(=O)N(CC(=O)N(Cc2ccccc2)Cc2cccs2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C28H33N3O2S/c1-22-14-16-24(17-15-22)29-28(33)31(25-11-6-3-7-12-25)21-27(32)30(20-26-13-8-18-34-26)19-23-9-4-2-5-10-23/h2,4-5,8-10,13-18,25H,3,6-7,11-12,19-21H2,1H3,(H,29,33) |
| InChIKey | KGBNOXKJKGWDAV-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.66 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |