C24H18F2N2O3 — CID 42783945
3-(3-fluorophenyl)-1-[(4-fluorophenyl)methyl]-1-[(4-oxochromen-3-yl)methyl]urea (PubChem CID 42783945) has the molecular formula C24H18F2N2O3 and a molecular weight of 420.42 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-1-[(4-fluorophenyl)methyl]-1-[(4-oxochromen-3-yl)methyl]urea.
| Compound Name | 3-(3-fluorophenyl)-1-[(4-fluorophenyl)methyl]-1-[(4-oxochromen-3-yl)methyl]urea |
|---|---|
| PubChem CID | 42783945 |
| Molecular Formula | C24H18F2N2O3 |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 3-(3-fluorophenyl)-1-[(4-fluorophenyl)methyl]-1-[(4-oxochromen-3-yl)methyl]urea |
| SMILES | O=C(Nc1cccc(F)c1)N(Cc1ccc(F)cc1)Cc1coc2ccccc2c1=O |
| InChI | InChI=1S/C24H18F2N2O3/c25-18-10-8-16(9-11-18)13-28(24(30)27-20-5-3-4-19(26)12-20)14-17-15-31-22-7-2-1-6-21(22)23(17)29/h1-12,15H,13-14H2,(H,27,30) |
| InChIKey | PFYCVSGFKHJDJF-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |