C23H22FNO3 — CID 7271249
N-[(4-fluorophenyl)methyl]-N-[(4-oxochromen-3-yl)methyl]cyclopentanecarboxamide (PubChem CID 7271249) has the molecular formula C23H22FNO3 and a molecular weight of 379.43 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-N-[(4-oxochromen-3-yl)methyl]cyclopentanecarboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-N-[(4-oxochromen-3-yl)methyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 7271249 |
| Molecular Formula | C23H22FNO3 |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-N-[(4-oxochromen-3-yl)methyl]cyclopentanecarboxamide |
| SMILES | O=C(C1CCCC1)N(Cc1ccc(F)cc1)Cc1coc2ccccc2c1=O |
| InChI | InChI=1S/C23H22FNO3/c24-19-11-9-16(10-12-19)13-25(23(27)17-5-1-2-6-17)14-18-15-28-21-8-4-3-7-20(21)22(18)26/h3-4,7-12,15,17H,1-2,5-6,13-14H2 |
| InChIKey | URWXUKWMAFNTQN-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |