C18H17F2NO — CID 110190860
N,N-bis[(4-fluorophenyl)methyl]cyclopropanecarboxamide (PubChem CID 110190860) has the molecular formula C18H17F2NO and a molecular weight of 301.34 g/mol. Its IUPAC name is N,N-bis[(4-fluorophenyl)methyl]cyclopropanecarboxamide.
| Compound Name | N,N-bis[(4-fluorophenyl)methyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 110190860 |
| Molecular Formula | C18H17F2NO |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | N,N-bis[(4-fluorophenyl)methyl]cyclopropanecarboxamide |
| SMILES | O=C(C1CC1)N(Cc1ccc(F)cc1)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C18H17F2NO/c19-16-7-1-13(2-8-16)11-21(18(22)15-5-6-15)12-14-3-9-17(20)10-4-14/h1-4,7-10,15H,5-6,11-12H2 |
| InChIKey | FSEZFTHVCYCETC-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |