C13H15BrN2O2 — CID 60912130
N-(2-amino-2-oxoethyl)-N-[(4-bromophenyl)methyl]cyclopropanecarboxamide (PubChem CID 60912130) has the molecular formula C13H15BrN2O2 and a molecular weight of 311.18 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-N-[(4-bromophenyl)methyl]cyclopropanecarboxamide.
| Compound Name | N-(2-amino-2-oxoethyl)-N-[(4-bromophenyl)methyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 60912130 |
| Molecular Formula | C13H15BrN2O2 |
| Molecular Weight | 311.18 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-N-[(4-bromophenyl)methyl]cyclopropanecarboxamide |
| SMILES | NC(=O)CN(Cc1ccc(Br)cc1)C(=O)C1CC1 |
| InChI | InChI=1S/C13H15BrN2O2/c14-11-5-1-9(2-6-11)7-16(8-12(15)17)13(18)10-3-4-10/h1-2,5-6,10H,3-4,7-8H2,(H2,15,17) |
| InChIKey | HNKICJMWASHKER-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.18 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |