C20H17BrN2O2 — CID 71892511
N-(2-amino-2-oxoethyl)-N-[(4-bromophenyl)methyl]naphthalene-2-carboxamide (PubChem CID 71892511) has the molecular formula C20H17BrN2O2 and a molecular weight of 397.27 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-N-[(4-bromophenyl)methyl]naphthalene-2-carboxamide.
| Compound Name | N-(2-amino-2-oxoethyl)-N-[(4-bromophenyl)methyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 71892511 |
| Molecular Formula | C20H17BrN2O2 |
| Molecular Weight | 397.27 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-N-[(4-bromophenyl)methyl]naphthalene-2-carboxamide |
| SMILES | NC(=O)CN(Cc1ccc(Br)cc1)C(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H17BrN2O2/c21-18-9-5-14(6-10-18)12-23(13-19(22)24)20(25)17-8-7-15-3-1-2-4-16(15)11-17/h1-11H,12-13H2,(H2,22,24) |
| InChIKey | QZOCKRKHIDZZJK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.27 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |