C17H17BrN2O3 — CID 167781208
N-(2-amino-2-oxoethyl)-N-benzyl-2-(4-bromo-2-hydroxyphenyl)acetamide (PubChem CID 167781208) has the molecular formula C17H17BrN2O3 and a molecular weight of 377.24 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-N-benzyl-2-(4-bromo-2-hydroxyphenyl)acetamide.
| Compound Name | N-(2-amino-2-oxoethyl)-N-benzyl-2-(4-bromo-2-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 167781208 |
| Molecular Formula | C17H17BrN2O3 |
| Molecular Weight | 377.24 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-N-benzyl-2-(4-bromo-2-hydroxyphenyl)acetamide |
| SMILES | NC(=O)CN(Cc1ccccc1)C(=O)Cc1ccc(Br)cc1O |
| InChI | InChI=1S/C17H17BrN2O3/c18-14-7-6-13(15(21)9-14)8-17(23)20(11-16(19)22)10-12-4-2-1-3-5-12/h1-7,9,21H,8,10-11H2,(H2,19,22) |
| InChIKey | VCXIGLWIQVGOBE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.24 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |