C22H20ClFN2O2 — CID 43813618
N-[(2-chloro-6-methoxyquinolin-3-yl)methyl]-N-[(4-fluorophenyl)methyl]cyclopropanecarboxamide (PubChem CID 43813618) has the molecular formula C22H20ClFN2O2 and a molecular weight of 398.87 g/mol. Its IUPAC name is N-[(2-chloro-6-methoxyquinolin-3-yl)methyl]-N-[(4-fluorophenyl)methyl]cyclopropanecarboxamide.
| Compound Name | N-[(2-chloro-6-methoxyquinolin-3-yl)methyl]-N-[(4-fluorophenyl)methyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 43813618 |
| Molecular Formula | C22H20ClFN2O2 |
| Molecular Weight | 398.87 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | N-[(2-chloro-6-methoxyquinolin-3-yl)methyl]-N-[(4-fluorophenyl)methyl]cyclopropanecarboxamide |
| SMILES | COc1ccc2nc(Cl)c(CN(Cc3ccc(F)cc3)C(=O)C3CC3)cc2c1 |
| InChI | InChI=1S/C22H20ClFN2O2/c1-28-19-8-9-20-16(11-19)10-17(21(23)25-20)13-26(22(27)15-4-5-15)12-14-2-6-18(24)7-3-14/h2-3,6-11,15H,4-5,12-13H2,1H3 |
| InChIKey | AGCRPEXNROLYEB-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.87 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|