C26H22ClFN2O2 — CID 3229754
N-[(2-chloro-6-methoxyquinolin-3-yl)methyl]-2-fluoro-N-[(3-methylphenyl)methyl]benzamide (PubChem CID 3229754) has the molecular formula C26H22ClFN2O2 and a molecular weight of 448.93 g/mol. Its IUPAC name is N-[(2-chloro-6-methoxyquinolin-3-yl)methyl]-2-fluoro-N-[(3-methylphenyl)methyl]benzamide.
| Compound Name | N-[(2-chloro-6-methoxyquinolin-3-yl)methyl]-2-fluoro-N-[(3-methylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 3229754 |
| Molecular Formula | C26H22ClFN2O2 |
| Molecular Weight | 448.93 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | N-[(2-chloro-6-methoxyquinolin-3-yl)methyl]-2-fluoro-N-[(3-methylphenyl)methyl]benzamide |
| SMILES | COc1ccc2nc(Cl)c(CN(Cc3cccc(C)c3)C(=O)c3ccccc3F)cc2c1 |
| InChI | InChI=1S/C26H22ClFN2O2/c1-17-6-5-7-18(12-17)15-30(26(31)22-8-3-4-9-23(22)28)16-20-13-19-14-21(32-2)10-11-24(19)29-25(20)27/h3-14H,15-16H2,1-2H3 |
| InChIKey | DSHKBVVGQZMKLY-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.93 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|