C23H25ClN2O4 — CID 3216967
N-[(2-chloro-6-methoxyquinolin-3-yl)methyl]-4-ethoxy-N-(2-methoxyethyl)benzamide (PubChem CID 3216967) has the molecular formula C23H25ClN2O4 and a molecular weight of 428.92 g/mol. Its IUPAC name is N-[(2-chloro-6-methoxyquinolin-3-yl)methyl]-4-ethoxy-N-(2-methoxyethyl)benzamide.
| Compound Name | N-[(2-chloro-6-methoxyquinolin-3-yl)methyl]-4-ethoxy-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 3216967 |
| Molecular Formula | C23H25ClN2O4 |
| Molecular Weight | 428.92 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | N-[(2-chloro-6-methoxyquinolin-3-yl)methyl]-4-ethoxy-N-(2-methoxyethyl)benzamide |
| SMILES | CCOc1ccc(C(=O)N(CCOC)Cc2cc3cc(OC)ccc3nc2Cl)cc1 |
| InChI | InChI=1S/C23H25ClN2O4/c1-4-30-19-7-5-16(6-8-19)23(27)26(11-12-28-2)15-18-13-17-14-20(29-3)9-10-21(17)25-22(18)24/h5-10,13-14H,4,11-12,15H2,1-3H3 |
| InChIKey | GFCQRCPWPPMRSU-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.92 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|