C28H27ClN2O4 — CID 3229697
N-[(2-chloro-6-methoxyquinolin-3-yl)methyl]-N-[(3,4-dimethoxyphenyl)methyl]-2-methylbenzamide (PubChem CID 3229697) has the molecular formula C28H27ClN2O4 and a molecular weight of 490.99 g/mol. Its IUPAC name is N-[(2-chloro-6-methoxyquinolin-3-yl)methyl]-N-[(3,4-dimethoxyphenyl)methyl]-2-methylbenzamide.
| Compound Name | N-[(2-chloro-6-methoxyquinolin-3-yl)methyl]-N-[(3,4-dimethoxyphenyl)methyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 3229697 |
| Molecular Formula | C28H27ClN2O4 |
| Molecular Weight | 490.99 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | N-[(2-chloro-6-methoxyquinolin-3-yl)methyl]-N-[(3,4-dimethoxyphenyl)methyl]-2-methylbenzamide |
| SMILES | COc1ccc2nc(Cl)c(CN(Cc3ccc(OC)c(OC)c3)C(=O)c3ccccc3C)cc2c1 |
| InChI | InChI=1S/C28H27ClN2O4/c1-18-7-5-6-8-23(18)28(32)31(16-19-9-12-25(34-3)26(13-19)35-4)17-21-14-20-15-22(33-2)10-11-24(20)30-27(21)29/h5-15H,16-17H2,1-4H3 |
| InChIKey | FGOUMPJUZQIINJ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.99 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|