C24H21ClN2O3 — CID 1459845
N-[(2-chloro-6-methylquinolin-3-yl)methyl]-N-[(2-methoxyphenyl)methyl]furan-2-carboxamide (PubChem CID 1459845) has the molecular formula C24H21ClN2O3 and a molecular weight of 420.90 g/mol. Its IUPAC name is N-[(2-chloro-6-methylquinolin-3-yl)methyl]-N-[(2-methoxyphenyl)methyl]furan-2-carboxamide.
| Compound Name | N-[(2-chloro-6-methylquinolin-3-yl)methyl]-N-[(2-methoxyphenyl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 1459845 |
| Molecular Formula | C24H21ClN2O3 |
| Molecular Weight | 420.90 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | N-[(2-chloro-6-methylquinolin-3-yl)methyl]-N-[(2-methoxyphenyl)methyl]furan-2-carboxamide |
| SMILES | COc1ccccc1CN(Cc1cc2cc(C)ccc2nc1Cl)C(=O)c1ccco1 |
| InChI | InChI=1S/C24H21ClN2O3/c1-16-9-10-20-18(12-16)13-19(23(25)26-20)15-27(24(28)22-8-5-11-30-22)14-17-6-3-4-7-21(17)29-2/h3-13H,14-15H2,1-2H3 |
| InChIKey | YCGKYIZNADUNNF-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.90 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|