C22H23ClN2O4 — CID 3219509
N-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-N-(1,4-dioxan-2-ylmethyl)furan-2-carboxamide (PubChem CID 3219509) has the molecular formula C22H23ClN2O4 and a molecular weight of 414.89 g/mol. Its IUPAC name is N-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-N-(1,4-dioxan-2-ylmethyl)furan-2-carboxamide.
| Compound Name | N-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-N-(1,4-dioxan-2-ylmethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 3219509 |
| Molecular Formula | C22H23ClN2O4 |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | N-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-N-(1,4-dioxan-2-ylmethyl)furan-2-carboxamide |
| SMILES | Cc1cc(C)c2nc(Cl)c(CN(CC3COCCO3)C(=O)c3ccco3)cc2c1 |
| InChI | InChI=1S/C22H23ClN2O4/c1-14-8-15(2)20-16(9-14)10-17(21(23)24-20)11-25(12-18-13-27-6-7-28-18)22(26)19-4-3-5-29-19/h3-5,8-10,18H,6-7,11-13H2,1-2H3 |
| InChIKey | IYIIXQBKWQVGOI-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|