C23H24ClN3O — CID 1459926
N-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-N-(pyridin-3-ylmethyl)cyclobutanecarboxamide (PubChem CID 1459926) has the molecular formula C23H24ClN3O and a molecular weight of 393.92 g/mol. Its IUPAC name is N-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-N-(pyridin-3-ylmethyl)cyclobutanecarboxamide.
| Compound Name | N-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-N-(pyridin-3-ylmethyl)cyclobutanecarboxamide |
|---|---|
| PubChem CID | 1459926 |
| Molecular Formula | C23H24ClN3O |
| Molecular Weight | 393.92 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | N-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-N-(pyridin-3-ylmethyl)cyclobutanecarboxamide |
| SMILES | Cc1cc(C)c2nc(Cl)c(CN(Cc3cccnc3)C(=O)C3CCC3)cc2c1 |
| InChI | InChI=1S/C23H24ClN3O/c1-15-9-16(2)21-19(10-15)11-20(22(24)26-21)14-27(23(28)18-6-3-7-18)13-17-5-4-8-25-12-17/h4-5,8-12,18H,3,6-7,13-14H2,1-2H3 |
| InChIKey | VNEVPYRSMXSBDD-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.92 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|