C21H18ClN3O3 — CID 43813641
N-[(6-chloro-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-N-(pyridin-3-ylmethyl)cyclopropanecarboxamide (PubChem CID 43813641) has the molecular formula C21H18ClN3O3 and a molecular weight of 395.85 g/mol. Its IUPAC name is N-[(6-chloro-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-N-(pyridin-3-ylmethyl)cyclopropanecarboxamide.
| Compound Name | N-[(6-chloro-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-N-(pyridin-3-ylmethyl)cyclopropanecarboxamide |
|---|---|
| PubChem CID | 43813641 |
| Molecular Formula | C21H18ClN3O3 |
| Molecular Weight | 395.85 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | N-[(6-chloro-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-N-(pyridin-3-ylmethyl)cyclopropanecarboxamide |
| SMILES | O=C(C1CC1)N(Cc1cccnc1)Cc1cc2cc3c(cc2nc1Cl)OCO3 |
| InChI | InChI=1S/C21H18ClN3O3/c22-20-16(6-15-7-18-19(28-12-27-18)8-17(15)24-20)11-25(21(26)14-3-4-14)10-13-2-1-5-23-9-13/h1-2,5-9,14H,3-4,10-12H2 |
| InChIKey | QMSCGAQKTJTDII-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.85 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|