C24H17ClFN3O3 — CID 1460041
N-[(6-chloro-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-N-[(4-fluorophenyl)methyl]pyridine-4-carboxamide (PubChem CID 1460041) has the molecular formula C24H17ClFN3O3 and a molecular weight of 449.87 g/mol. Its IUPAC name is N-[(6-chloro-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-N-[(4-fluorophenyl)methyl]pyridine-4-carboxamide.
| Compound Name | N-[(6-chloro-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-N-[(4-fluorophenyl)methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 1460041 |
| Molecular Formula | C24H17ClFN3O3 |
| Molecular Weight | 449.87 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | N-[(6-chloro-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-N-[(4-fluorophenyl)methyl]pyridine-4-carboxamide |
| SMILES | O=C(c1ccncc1)N(Cc1ccc(F)cc1)Cc1cc2cc3c(cc2nc1Cl)OCO3 |
| InChI | InChI=1S/C24H17ClFN3O3/c25-23-18(9-17-10-21-22(32-14-31-21)11-20(17)28-23)13-29(12-15-1-3-19(26)4-2-15)24(30)16-5-7-27-8-6-16/h1-11H,12-14H2 |
| InChIKey | NNBWSKXGAMMKFW-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.87 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|