C22H22ClFN2O3 — CID 1459994
N-[(2-chloro-6-ethoxyquinolin-3-yl)methyl]-N-[(4-fluorophenyl)methyl]-2-methoxyacetamide (PubChem CID 1459994) has the molecular formula C22H22ClFN2O3 and a molecular weight of 416.88 g/mol. Its IUPAC name is N-[(2-chloro-6-ethoxyquinolin-3-yl)methyl]-N-[(4-fluorophenyl)methyl]-2-methoxyacetamide.
| Compound Name | N-[(2-chloro-6-ethoxyquinolin-3-yl)methyl]-N-[(4-fluorophenyl)methyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 1459994 |
| Molecular Formula | C22H22ClFN2O3 |
| Molecular Weight | 416.88 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | N-[(2-chloro-6-ethoxyquinolin-3-yl)methyl]-N-[(4-fluorophenyl)methyl]-2-methoxyacetamide |
| SMILES | CCOc1ccc2nc(Cl)c(CN(Cc3ccc(F)cc3)C(=O)COC)cc2c1 |
| InChI | InChI=1S/C22H22ClFN2O3/c1-3-29-19-8-9-20-16(11-19)10-17(22(23)25-20)13-26(21(27)14-28-2)12-15-4-6-18(24)7-5-15/h4-11H,3,12-14H2,1-2H3 |
| InChIKey | XUFPKPRAILAWIK-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.88 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|