C23H20ClF2NO5S — CID 46135776
[4-chloro-2-[[(4-fluorophenyl)methyl-(2-methoxyacetyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 46135776) has the molecular formula C23H20ClF2NO5S and a molecular weight of 495.93 g/mol. Its IUPAC name is [4-chloro-2-[[(4-fluorophenyl)methyl-(2-methoxyacetyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [4-chloro-2-[[(4-fluorophenyl)methyl-(2-methoxyacetyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 46135776 |
| Molecular Formula | C23H20ClF2NO5S |
| Molecular Weight | 495.93 g/mol |
| Exact Mass | 495.07 |
| IUPAC Name | [4-chloro-2-[[(4-fluorophenyl)methyl-(2-methoxyacetyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | COCC(=O)N(Cc1ccc(F)cc1)Cc1cc(Cl)ccc1OS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H20ClF2NO5S/c1-31-15-23(28)27(13-16-2-5-19(25)6-3-16)14-17-12-18(24)4-11-22(17)32-33(29,30)21-9-7-20(26)8-10-21/h2-12H,13-15H2,1H3 |
| InChIKey | IZEKRFQQOVMUKD-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.93 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|