C29H23ClF2N2O5S — CID 46135749
[4-chloro-2-[[(3-fluorobenzoyl)-[(4-fluorophenyl)methyl]amino]methyl]phenyl] 4-acetamidobenzenesulfonate (PubChem CID 46135749) has the molecular formula C29H23ClF2N2O5S and a molecular weight of 585.03 g/mol. Its IUPAC name is [4-chloro-2-[[(3-fluorobenzoyl)-[(4-fluorophenyl)methyl]amino]methyl]phenyl] 4-acetamidobenzenesulfonate.
| Compound Name | [4-chloro-2-[[(3-fluorobenzoyl)-[(4-fluorophenyl)methyl]amino]methyl]phenyl] 4-acetamidobenzenesulfonate |
|---|---|
| PubChem CID | 46135749 |
| Molecular Formula | C29H23ClF2N2O5S |
| Molecular Weight | 585.03 g/mol |
| Exact Mass | 584.10 |
| IUPAC Name | [4-chloro-2-[[(3-fluorobenzoyl)-[(4-fluorophenyl)methyl]amino]methyl]phenyl] 4-acetamidobenzenesulfonate |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Oc2ccc(Cl)cc2CN(Cc2ccc(F)cc2)C(=O)c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C29H23ClF2N2O5S/c1-19(35)33-26-10-12-27(13-11-26)40(37,38)39-28-14-7-23(30)15-22(28)18-34(17-20-5-8-24(31)9-6-20)29(36)21-3-2-4-25(32)16-21/h2-16H,17-18H2,1H3,(H,33,35) |
| InChIKey | UIXHLINGSVVTBF-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.03 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|