C14H11F2NO4S — CID 51178770
(2,4-difluorophenyl) 4-acetamidobenzenesulfonate (PubChem CID 51178770) has the molecular formula C14H11F2NO4S and a molecular weight of 327.31 g/mol. Its IUPAC name is (2,4-difluorophenyl) 4-acetamidobenzenesulfonate.
| Compound Name | (2,4-difluorophenyl) 4-acetamidobenzenesulfonate |
|---|---|
| PubChem CID | 51178770 |
| Molecular Formula | C14H11F2NO4S |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | (2,4-difluorophenyl) 4-acetamidobenzenesulfonate |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Oc2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C14H11F2NO4S/c1-9(18)17-11-3-5-12(6-4-11)22(19,20)21-14-7-2-10(15)8-13(14)16/h2-8H,1H3,(H,17,18) |
| InChIKey | SRARZPFQLMOERG-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|