C15H12F2N2O4S — CID 53363575
(2,4-difluorophenyl) 4-(2-oxoimidazolidin-1-yl)benzenesulfonate (PubChem CID 53363575) has the molecular formula C15H12F2N2O4S and a molecular weight of 354.33 g/mol. Its IUPAC name is (2,4-difluorophenyl) 4-(2-oxoimidazolidin-1-yl)benzenesulfonate.
| Compound Name | (2,4-difluorophenyl) 4-(2-oxoimidazolidin-1-yl)benzenesulfonate |
|---|---|
| PubChem CID | 53363575 |
| Molecular Formula | C15H12F2N2O4S |
| Molecular Weight | 354.33 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | (2,4-difluorophenyl) 4-(2-oxoimidazolidin-1-yl)benzenesulfonate |
| SMILES | O=C1NCCN1c1ccc(S(=O)(=O)Oc2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C15H12F2N2O4S/c16-10-1-6-14(13(17)9-10)23-24(21,22)12-4-2-11(3-5-12)19-8-7-18-15(19)20/h1-6,9H,7-8H2,(H,18,20) |
| InChIKey | VUYXOICKLGGBLQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.33 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|