C15H9F5N2O4S — CID 53363577
(2,3,4,5,6-pentafluorophenyl) 4-(2-oxoimidazolidin-1-yl)benzenesulfonate (PubChem CID 53363577) has the molecular formula C15H9F5N2O4S and a molecular weight of 408.30 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 4-(2-oxoimidazolidin-1-yl)benzenesulfonate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 4-(2-oxoimidazolidin-1-yl)benzenesulfonate |
|---|---|
| PubChem CID | 53363577 |
| Molecular Formula | C15H9F5N2O4S |
| Molecular Weight | 408.30 g/mol |
| Exact Mass | 408.02 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 4-(2-oxoimidazolidin-1-yl)benzenesulfonate |
| SMILES | O=C1NCCN1c1ccc(S(=O)(=O)Oc2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C15H9F5N2O4S/c16-9-10(17)12(19)14(13(20)11(9)18)26-27(24,25)8-3-1-7(2-4-8)22-6-5-21-15(22)23/h1-4H,5-6H2,(H,21,23) |
| InChIKey | LADHZSQJQVQOCK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.30 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|